LBF20403SC01
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0215 |
LipidMaps | LMFA01030176 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20403SC01.mol |
![]() | |
Structural Information | |
Systematic Name | 8, 11, 14, 17-Eicosatetraenoic acid / 8, 11, 14, 17-icosatetraenoic acid |
Common Name | |
Symbol | |
Formula | C20H32O2 |
Exact Mass | 304.240230268 |
Average Mass | 304.46688 |
SMILES | C(CC=CCC=CCC=CCCCCCCC(O)=O)=CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in acetone, methyl alcohol and petroleum ether.<<0464>><<0465>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |