LBF19000BC01
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0242 |
| LipidMaps | LMFA01020017 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF19000BC01.mol |
| Isoarachidic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 18-Methylnonadecanoic acid |
| Common Name |
|
| Symbol | |
| Formula | C20H40O2 |
| Exact Mass | 312.302830524 |
| Average Mass | 312.53040000000004 |
| SMILES | C(CCCCCCCCC(O)=O)CCCCCCCC(C)C |
| Physicochemical Information | |
| Melting Point | 75.3°C |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in ethanol , ether and petroleum ether.<<0357>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
