LBF18403SC02
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0207 |
| LipidMaps | LMFA01030168 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18403SC02.mol |
| Moroctic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 4, 8, 12, 15-Octadecatetraenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C18H28O2 |
| Exact Mass | 276.20893014 |
| Average Mass | 276.41372 |
| SMILES | CCC=CCC=CCCC=CCCC=CCCC(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | 208-215°C at 15 mmHg |
| Density | 0.9297 at 20°C |
| Optical Rotation | 1.4911at 20°C |
| Reflactive Index | |
| Solubility | soluble in acetone, alcohol, ether and petroleum ether.<<0103>><<0472>><<0489>><<0500>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
