LBF18305SC04
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0188 |
LipidMaps | - |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18305SC04.mol |
beta-Eleostearic acid | |
---|---|
Structural Information | |
Systematic Name | trans-9, trans-11, trans-13-Octadecatrienoic acid |
Common Name |
|
Symbol | |
Formula | C18H30O2 |
Exact Mass | 278.224580204 |
Average Mass | 278.4296 |
SMILES | CCCCC=CC=CC=CCCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | 71-71.5°C |
Boiling Point | 188°C at 1 mmHg |
Density | dX475 0.8909 |
Optical Rotation | 1.5011 at 75°C |
Reflactive Index | |
Solubility | soluble in ethanol, methylalcohol and petroleum ether.<<0010>><<0067>><<0387>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |