LBF18303SC02
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0192 |
LipidMaps | LMFA01030153 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18303SC02.mol |
Elaidolinoleic acid | |
---|---|
Structural Information | |
Systematic Name | trans-9, trans-12, trans-15-Octadecatrienoic acid |
Common Name |
|
Symbol | |
Formula | C18H30O2 |
Exact Mass | 278.224580204 |
Average Mass | 278.4296 |
SMILES | CCC=CCC=CCC=CCCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | 29.5-30°C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | solubule in methylalcohol and petroleum ether.<<0279>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |