LBF18109MO03
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8037 |
LipidMaps | LMFA01080006 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18109MO03.mol |
Structural Information | |
---|---|
Systematic Name | 12,13-Dihydroxy-11-Methoxy-9-Octadecenoic Acid |
Common Name | |
Symbol | |
Formula | C19H36O5 |
Exact Mass | 344.256274262 |
Average Mass | 344.48614000000003 |
SMILES | CCCCCC(O)C(O)C(OC)C=CCCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after methanolysis and trimethylsilylation)<<8070>>: m/e=227[CHOCH3CH=CH(CH2)7COOCH3], 300[227+TMS], 275[M-227], 185[275-HOTMS], 173[SMTO=CH(CH2)4CH3] |
UV Spectra | |
IR Spectra | Methyl ester(CS2)<<8070>>: cis olefin(750cm-1), OH(3550 and 3490cm-1) |
NMR Spectra | 1H-NMR(methyl ester; CDCl3,300MHz)<<8070>>: C9(5.74ppm), C10(5.37ppm), C11(4.11ppm), C12(3.62ppm), C13(3.45ppm), C11OCH3(3.27ppm), C12OH(2.39ppm), C13OH(2.70ppm), J9-10=11.2Hz(cis unsaturation) |
Chromatograms |