LBF18104HP01
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA8076 |
LipidMaps | LMFA01040057 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18104HP01.mol |
Structural Information | |
---|---|
Systematic Name | Methyl-10,12,13,16-Bisepidioxy-9-Hydroperoxy-14-Octadecenoate |
Common Name | |
Symbol | |
Formula | C19H32O8 |
Exact Mass | 388.20971799999995 |
Average Mass | 388.45258 |
SMILES | C(C(O2)CC(O2)C(OO)CCCCCCCC(=O)OC)(C=1)OOC(CC)C1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after reduction(PH3P) and TMS-derivatization)<<8085>>: m/e=259[SMTO=CH(CH2)7COOCH3]; 185[M-259]; GC-EI-MS(after reduction, hydrogenation, and TMS-derivatization)<<8085>>: m/e=389[M-259-HOTMS]; 387[M-261-HOTMS]; 297[387-HOTMS] |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H-NMR<<8085>>: C8: 1.6ppm; C9: 4.08ppm; C10, 12, 13, 16: 4.45ppm; C11: 2.1-2.7ppm; C14, 15: 5.68ppm; OOH: 8.45ppm |
Chromatograms |