LBF18000HO24
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0357 |
| LipidMaps | LMFA01050091 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18000HO24.mol |
| 9,12-Dihydroxystearic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 9,12-Dihydroxyoctadecanoic acid |
| Common Name |
|
| Symbol | |
| Formula | C18H36O4 |
| Exact Mass | 316.26135963999997 |
| Average Mass | 316.47604 |
| SMILES | CCCCCCC(O)CCC(O)CCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | 90°C |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in alcohol ; sparingly soluble in ethanol ; insoluble in petroleum and ethanol<<0200>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
