LBF18000BC01
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | DFA0240 |
| LipidMaps | LMFA01020015 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18000BC01.mol |
| Tuberculostearic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | l- (+) -10-Methyloctadecanoic acid |
| Common Name |
|
| Symbol | |
| Formula | C19H38O2 |
| Exact Mass | 298.28718046 |
| Average Mass | 298.50382 |
| SMILES | CCCCCCCCC(C)CCCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | 13.2°C |
| Boiling Point | 175-178°C at 760mmHg |
| Density | dX4250.887 |
| Optical Rotation | 1.4512 at 25°C |
| Reflactive Index | |
| Solubility | soluble in acetone , ethanol , methyl alcohol and pentane.<<0407>><<0430>><<0459>><<0524>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
