LBF17000BC01
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0238 |
| LipidMaps | LMFA01020013 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF17000BC01.mol |
| |
| Structural Information | |
| Systematic Name | 10-Methylheptadecanoic acid |
| Common Name | |
| Symbol | |
| Formula | C18H36O2 |
| Exact Mass | 284.271530396 |
| Average Mass | 284.47724 |
| SMILES | CCCCCCCC(C)CCCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | 33.5°C |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in acetone and glacial acetic acid<<0459>><<0525>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
