FLNC49NS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLN Neoflavonoid : FLNC Dalbergiquinol : FLNC49 2,3,4,5,(3'),(5')-Hydroxydalbergiquinol and O-methyl derivatives (0 pages) : FLNC49NS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 1857-06-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLNC49NS0001.mol |
| (R) -3,4Dimethoxydalbergionequinol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (R) -2,5-Dihydroxy-3,4-dimethoxydalbergiquinol |
| Common Name |
|
| Symbol | |
| Formula | C17H18O4 |
| Exact Mass | 286.120509064 |
| Average Mass | 286.32241999999997 |
| SMILES | COc(c(O)2)c(OC)c(O)c(c2)[C@]([H])(C=C)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
