FLID1CNF0001
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 13401-64-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLID1CNF0001.mol |
| Edulin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | [ 6aR,12aR, (-) ] -6a,12a-Dihydro-6H- [ 1,3 ] dioxolo [ 5,6 ] benzofuro [ 3,2-c ] furo [ 3,2-g ] [ 1 ] benzopyran |
| Common Name |
|
| Symbol | |
| Formula | C18H12O5 |
| Exact Mass | 308.068473494 |
| Average Mass | 308.28488 |
| SMILES | c(c56)c(O4)c(cc5OCO6)C(C43)COc(c23)cc(c(c2)1)occ1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
