FLIAEAGS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIAEA 6-Hydroxygenistein and O-methyl derivatives (21 pages) : FLIAEAGS O-Glycoside (9 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 611-40-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAEAGS0001.mol |
| Shekanin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3- (4-Hydroxyphenyl) -5-hydroxy-7- [ (beta-D-glucopyranosyl) oxy ] -6-methoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C22H22O11 |
| Exact Mass | 462.116211546 |
| Average Mass | 462.40348000000006 |
| SMILES | COc(c3O[C@@H]([C@@H](O)4)OC(CO)[C@@H]([C@@H]4O)O)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
