BMMCPYCT0023
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 951-77-9 |
| KEGG | C00881 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCPYCT0023.mol |
| Deoxycytidine | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Deoxy-cytidine |
| Common Name |
|
| Symbol | |
| Formula | C9H13N3O4 |
| Exact Mass | 227.0906 |
| Average Mass | 227.2173 |
| SMILES | OC[C@@H](O1)[C@@H](O)C[C@@H]1N(C=2)C(=O)N=C(N)C2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
