BMMCBZ3Sk049
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 1135-24-6 |
| KEGG | C01494 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCBZ3Sk049.mol |
| Ferulate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Ferulic acid |
| Common Name |
|
| Symbol | |
| Formula | C10H10O4 |
| Exact Mass | 194.0579 |
| Average Mass | 194.184 |
| SMILES | COc(c1)c(O)ccc(C=CC(O)=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
- S-Adenosyl-L-methionine ⇔ this
- trans-3- (3,4-Dihydroxyphenyl) prop-2-enoic acid ⇔ this
- this ⇔ S- [2- [3- [ [4- [ [ [(2R,3S,4R,5R) -5- (6-Aminopurin-9-yl) -4-hydroxy-3-phosphonooxyoxolan-2-yl] methoxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] oxy-2-hydroxy-3,3-dimethylbutanoyl] amino] propanoylamino] ethyl] (E) -3- (4-hydroxy-3-methoxyphenyl) prop-2-enethioic acid
- this ⇔ 5-Hydroxy-ferulic acid
