BMMCBZ2Pk004
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 17199-29-0 |
| KEGG | C03198 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCBZ2Pk004.mol |
| (S)-4-Hydroxymandelate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (S)-4-Hydroxy-mandelic acid |
| Common Name |
|
| Symbol | |
| Formula | C8H8O4 |
| Exact Mass | 168.0422 |
| Average Mass | 168.1467 |
| SMILES | Oc(c1)ccc(c1)[C@H](O)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
