BMFYS6CAm002
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 34281-55-5 |
KEGG | C01186 |
KNApSAcK | |
CDX file | |
MOL file | BMFYS6CAm002.mol |
(3S,5S) -3,5-Diaminohexanoate | |
---|---|
Structural Information | |
Systematic Name | (3S,5S) -3,5-Diamino-hexanoic acid |
Common Name |
|
Symbol | |
Formula | C6H14N2O2 |
Exact Mass | 146.1055 |
Average Mass | 146.1876 |
SMILES | C[C@H](N)C[C@H](N)CC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways