BMFYB6DAk008
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C05662 |
KNApSAcK | |
CDX file | |
MOL file | BMFYB6DAk008.mol |
Homoisocitrate | |
---|---|
Structural Information | |
Systematic Name | Homoisocitric acid |
Common Name |
|
Symbol | |
Formula | C7H10O7 |
Exact Mass | 206.0426 |
Average Mass | 206.1501 |
SMILES | OC(=O)CCC(C(O)=O)C(O)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways