BMCCID--i031
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 1210-83-9 |
| KEGG | C00978 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCID--i031.mol |
| N-Acetylserotonin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | N-Acetyl-serotonin |
| Common Name |
|
| Symbol | |
| Formula | C12H14N2O2 |
| Exact Mass | 218.1055 |
| Average Mass | 218.2518 |
| SMILES | CC(=O)NCCc(c1)c(c2)c(ccc(O)2)n1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
- this ⇔ N- [2- (5-Methoxy-1H-indol-3-yl) ethyl] acetamide
- 3- (2-Aminoethyl) -1H-indol-5-ol ⇔ this
- S- [2- [3- [ [ (2R) -4- [ [ [ (2R,3S,4R,5R) -5- (6-Aminopurin-9-yl) -4-hydroxy-3-phosphonooxyoxolan-2-yl] methoxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] oxy-2-hydroxy-3,3-dimethylbutanoyl] amino] propanoylamino] ethyl] ethanethioate ⇔ this
