BMCCBR--o003
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | D00126 |
KNApSAcK | |
CDX file | |
MOL file | BMCCBR--o003.mol |
![]() | |
Structural Information | |
Systematic Name | ent-Kaur-16-en-19-al |
Common Name | |
Symbol | |
Formula | C20H30O |
Exact Mass | 286.229665582 |
Average Mass | 286.4516 |
SMILES | O=C[C@@](C)(C4)[C@@H](C3)[C@](C)(CC4)[C@H](C2)[C@] |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways