LBF22503SC02
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0223 |
LipidMaps | LMFA01030184 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF22503SC02.mol |
Structural Information | |
---|---|
Systematic Name | 7, 10, 13, 16, 19-Docosapentaenoic acid |
Common Name | |
Symbol | |
Formula | C22H34O2 |
Exact Mass | 330.255880332 |
Average Mass | 330.50416000000007 |
SMILES | C(CCC(O)=O)CCC=CCC=CCC=CCC=CCC=CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in benzene, chloroform, ether, methyl alcohol and petroleum ether.<<0005>><<0006>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms | Gas liquid chromatogram (provided by Dr. Akiko Horiuchi). |