LBF22206SC01
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0171 |
LipidMaps | LMFA01030132 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF22206SC01.mol |
Structural Information | |
---|---|
Systematic Name | 13, 16-Docosadienoic acid |
Common Name | |
Symbol | |
Formula | C22H40O2 |
Exact Mass | 336.302830524 |
Average Mass | 336.5518 |
SMILES | C(CCC(O)=O)CCCCCCCCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in acetone and ether.<<0045>><<0241>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |