LBF20406AM31
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | XPR7048 |
LipidMaps | LMFA08020034 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM31.mol |
![]() | |
Structural Information | |
Systematic Name | N-propyl alpha,alpha-dimethylarachidonoyl amide |
Common Name | |
Symbol | |
Formula | C25H43NO |
Exact Mass | 373.334465003 |
Average Mass | 373.61505999999997 |
SMILES | C(CC=CCCC(C)(C)C(NCCC)=O)=CCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.60 (br s, lH), 5.30-5.40 (m, 8H), 3.20-3.23 (m, 2H), 2.79-2.84 (m, 6H), 2.00-2.10 (m, 4H), 1.20-1.60 (series of m, 10H), 1.15 (s, 6H), 0.86-0.94 (m, 6H). <<7001>> |
Chromatograms |