LBF20406AM18
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | XPR7034 |
| LipidMaps | LMFA08020020 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM18.mol |
| |
| Structural Information | |
| Systematic Name | N- (5-hydroxypentyl) arachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C25H43NO2 |
| Exact Mass | 389.329379625 |
| Average Mass | 389.61446 |
| SMILES | C(CCCCNC(CCCC=CCC=CCC=CCC=CCCCCC)=O)O |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.60 (br s lH), 5.22-5.42 (m, 8H), 3.64 (t, J=5.5Hz, 2H), 3.20-3.32 (m, 2H), 2.76-2.89 (m, 6H), 2.00-2.22 (m, 6H), 1.90 (br s lH), 1.20-1.80 (series of m, l4H), 0.89 (t, J=7.1Hz, 3H). <<7001>> |
| Chromatograms | |
