LBF20404SC01
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0212 |
LipidMaps | LMFA01030173 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20404SC01.mol |
Structural Information | |
---|---|
Systematic Name | 4, 8, 12, 16-Eicosatetraenoic acid / 4, 8, 12, 16-icosatetraenoic acid |
Common Name | |
Symbol | |
Formula | C20H32O2 |
Exact Mass | 304.240230268 |
Average Mass | 304.46688 |
SMILES | C(=CCCC=CCCC=CCCC=CCCC(O)=O)CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | 217 to 220 °C at 20 mmHg |
Density | 0.9263 at 20 °C |
Optical Rotation | 1.4915 at 20 °C |
Reflactive Index | |
Solubility | soluble in acetone, methyl alcohol, ether and petroleum ether.<<0442>><<0489>><<0496>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |