LBF20111SC01
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | DFA0123 |
| LipidMaps | LMFA01030084 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20111SC01.mol |
| cis-Gadoleic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | cis-9-Eicosenoic acid / cis-9-icosenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C20H38O2 |
| Exact Mass | 310.28718046 |
| Average Mass | 310.51452 |
| SMILES | C(CCCCCCC=CCCCCCCCC(O)=O)CCC |
| Physicochemical Information | |
| Melting Point | 23-23.5°C |
| Boiling Point | 170°C at 0.1 mmHg |
| Density | dX425 0.882 |
| Optical Rotation | 1.4597 at 25°C |
| Reflactive Index | |
| Solubility | soluble in acetone, methylalcohol and petroleumether <<0106>> <<0234>> <<0332>> <<0487>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
