FL1AE9NS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1A Aurone : FL1AE9 4,5,6,(3'),(5')-Hydroxyaurone and O-methyl derivatives (0 pages) : FL1AE9NS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 135383-79-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1AE9NS0001.mol |
| 4,5-Methylenedioxy-6-hydroxyaurone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (Z) -4-Hydroxy-7- (phenylmethylene) -furo [ 3,2-e ] -1,3-benzodioxol-8 (7H) -one |
| Common Name |
|
| Symbol | |
| Formula | C16H10O5 |
| Exact Mass | 282.05282343 |
| Average Mass | 282.2476 |
| SMILES | c(c4)ccc(c4)C=c(o3)c(=O)c(c13)c(O2)c(OC2)c(O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
