BMMCBZ2Pk032
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C01179 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCBZ2Pk032.mol |
| 3- (4-Hydroxyphenyl) pyruvate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 4-Hydroxy-phenyl-pyruvic acid |
| Common Name |
|
| Symbol | |
| Formula | C9H8O4 |
| Exact Mass | 180.0422 |
| Average Mass | 180.1574 |
| SMILES | Oc(c1)ccc(c1)CC(=O)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
- (2S) -2-Amino-3- (4-hydroxyphenyl) propanoic acid ⇔ this
- 4-Hydroxy-1- (3-hydroxy-2,3-dioxopropyl) cyclohexa-2,5-diene-1-carboxylic acid ⇔ this
- (R) -3- (4-Hydroxy-phenyl) -lactic acid ⇔ this
- this ⇔ (Z) -2-Hydroxy-3- (4-hydroxyphenyl) prop-2-enoic acid
- this ⇔ 4-Hydroxy-phenyl-acetaldehyde
- this ⇔ CO2
- 3-(4-Hydroxy-phenyl)-lactic acid ⇔ this
