BMAXDP--0013
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 32468-23-8 |
KEGG | D00124 |
KNApSAcK | |
CDX file | |
MOL file | BMAXDP--0013.mol |
![]() | |
Structural Information | |
Systematic Name | L-Cysteinyl-D-valine |
Common Name | |
Symbol | |
Formula | C8H16N2O3S |
Exact Mass | 220.0881 |
Average Mass | 220.2903 |
SMILES | CC(C)[C@H](C(O)=O)NC(=O)[C@@H](N)CS |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways