LBF22503SC01
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0222 |
| LipidMaps | LMFA01030183 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF22503SC01.mol |
| Clupanodonic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 4, 8, 12, 15, 19-Docosapentaenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C22H34O2 |
| Exact Mass | 330.255880332 |
| Average Mass | 330.50416000000007 |
| SMILES | C(CCC(O)=O)=CCCC=CCCC=CCC=CCCC=CCC |
| Physicochemical Information | |
| Melting Point | -78 °C |
| Boiling Point | 207 to 212 at 2 mmHg |
| Density | 0.9356 at 20 °C |
| Optical Rotation | 1.5014 at 20 °C |
| Reflactive Index | |
| Solubility | soluble in acetone, ether and petroleum ether.<<0470>><<0501>><<0502>><<0505>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
