LBF20406SC01
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0213 |
LipidMaps | LMFA01030001 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406SC01.mol |
Arachidonic acid | |
---|---|
Structural Information | |
Systematic Name | 5, 8, 11, 14-Eicosatetraenoic acid / 5, 8, 11, 14-icosatetraenoic acid |
Common Name |
|
Symbol | |
Formula | C20H32O2 |
Exact Mass | 304.240230268 |
Average Mass | 304.46688 |
SMILES | C(CC=CCC=CCC=CCC=CCCCC(O)=O)CCC |
Physicochemical Information | |
Melting Point | -49.5 °C |
Boiling Point | 163 °C at 1 mmHg |
Density | 0.9082 at 20 °C |
Optical Rotation | 1.4824 at 20 °C |
Reflactive Index | |
Solubility | soluble in acetone, methyl alcohol, ether and petroleum ether.<<0224>><<0225>><<0328>><<0347>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |