LBF20406AM22
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7038 |
| LipidMaps | LMFA08020024 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM22.mol |
| |
| Structural Information | |
| Systematic Name | N,N-diethyl arachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C24H41NO |
| Exact Mass | 359.318814939 |
| Average Mass | 359.58847999999995 |
| SMILES | N(C(CCCC=CCC=CCC=CCC=CCCCCC)=O)(CC)CC |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.30-5.42 (m, 8H), 3.20-3.42 (m, 4H), 2.76-2.86 (m, 6H), 2.29 (t, J=7.l Hz, 2H), 2.00-2.20 (m, 4H), 1.60-1.80 (m, 2H), 1.22-1.40 (m, 6H), 1.04-1.20 (m, 6H), 0.90 (t, J=6.1Hz, 3H). <<7001>> |
| Chromatograms | |
