LBF20212LT01
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR3112 |
LipidMaps | LMFA03020004 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20212LT01.mol |
10,11,14,15-tetrahydro-12-keto-Leukotriene B4 | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 5S-hydroxy-12R-keto- [ 6Z, 8E ] -eicosatedienoic acid |
Common Name |
|
Symbol | |
Formula | C20H34O4 |
Exact Mass | 338.24570957599997 |
Average Mass | 338.48156 |
SMILES | C(CCCCC(CCC=CC=C[C@H](CCCC(O)=O)O)=O)CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | Soluble in ethanol, methanol, ethyl acetate, acetonitril |
Spectral Information | |
Mass Spectra | |
UV Spectra | UV maxima 235 nm, Absorbance at 320 nm is 30500/M |
IR Spectra | |
NMR Spectra | |
Chromatograms | 10, 11, 14, 15-tetrahydro-12-oxo-LTB4 is eluted at 12.6min on RP-HPLC system as follows: Solvent:acetonitril/water/acetic acid, 50:50:0.01 (v/v/v), 0.01 % (w/v) Na2EDTA, pH 5.6 with ammonia Flow: 1 ml/min, isocratic Column: Cosmosil 5C18-AR (4.6 x 150 mm, Nacalai tesque, Tokyo) <<3111>> |