FLIA9ANS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=Pallidiflorin | + | |SysName=Pallidiflorin |
|Common Name=&&Pallidiflorin&&5-Hydroxy-4'-methoxyisoflavone&& | |Common Name=&&Pallidiflorin&&5-Hydroxy-4'-methoxyisoflavone&& | ||
|CAS=133086-79-0 | |CAS=133086-79-0 | ||
|KNApSAcK=C00009842 | |KNApSAcK=C00009842 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 133086-79-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIA9ANS0001.mol |
| Pallidiflorin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Pallidiflorin |
| Common Name |
|
| Symbol | |
| Formula | C16H12O4 |
| Exact Mass | 268.073558872 |
| Average Mass | 268.26408 |
| SMILES | COc(c3)ccc(c3)C(=C1)C(=O)c(c(O)2)c(ccc2)O1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
