FL7DAAGO0002
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 53948-06-4 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL7DAAGO0002.mol | 
| Apigeninidin 7-glucoside | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | Apigeninidin 7-glucoside | 
| Common Name | 
  | 
| Symbol | |
| Formula | C21H21O9 | 
| Exact Mass | 417.11855727 | 
| Average Mass | 417.38604 | 
| SMILES |  Oc(c4)ccc(c4)c(c3)[o+1]c(c(c3)2)cc(cc2O)OC(O1)C(O) | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
