FL6DDANI0002
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 1: | Line 1: | ||
| {{Metabolite | {{Metabolite | ||
| |SysName=3,7,4'-Trihydroxy-4,5-dimethyl-8-prenylflavan | |SysName=3,7,4'-Trihydroxy-4,5-dimethyl-8-prenylflavan | ||
| − | |Common Name=&&4,5-Di-O-methyl-8-prenylafzelechin-4beta-ol&& | + | |Common Name=&&4,5-Di-O-methyl-8-prenylafzelechin-4beta-ol&&3,7,4'-Trihydroxy-4,5-dimethyl-8-prenylflavan&& | 
| |CAS=72357-34-7 | |CAS=72357-34-7 | ||
| |KNApSAcK=C00009030 | |KNApSAcK=C00009030 | ||
| }} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 72357-34-7 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL6DDANI0002.mol | 
| 4,5-Di-O-methyl-8-prenylafzelechin-4beta-ol | |
|---|---|
|   | |
| Structural Information | |
| Systematic Name | 3,7,4'-Trihydroxy-4,5-dimethyl-8-prenylflavan | 
| Common Name | 
 | 
| Symbol | |
| Formula | C22H26O6 | 
| Exact Mass | 386.172938564 | 
| Average Mass | 386.43824 | 
| SMILES | c(c1)(ccc(C(C3O)Oc(c2CC=C(C)C)c(C3OC)c(OC)cc2O)c1) | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | 
