FL6D3CNS0004
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|SysName= (2R,3S,4R) -3,4,7,3',4'-Pentahydroxy-8-methoxyflavan | |SysName= (2R,3S,4R) -3,4,7,3',4'-Pentahydroxy-8-methoxyflavan | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL6D Flavan 3,4-diol : FL6D3C Mesquitol 4-ol, Epimesquitol 4-ol and O-methyl derivatives (5 pages) : FL6D3CNS Simple substitution (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 29810-21-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL6D3CNS0004.mol |
| Mesquitol-4alpha-ol 8-methyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R,3S,4R) -3,4,7,3',4'-Pentahydroxy-8-methoxyflavan |
| Common Name |
|
| Symbol | |
| Formula | C16H16O7 |
| Exact Mass | 320.089602866 |
| Average Mass | 320.29404 |
| SMILES | COc(c(O)3)c(O1)c(cc3)[C@@H](O)[C@H](O)[C@H]1c(c2)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
