FL6D1CNS0005
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=(2S,3S,4S)-3,4,7,3',4'-Pentahydroxyflavan | + | |SysName= (2S,3S,4S) -3,4,7,3',4'-Pentahydroxyflavan |
− | |Common Name=&&ent-Epifisetinidol-4beta-ol&&(2S,3S,4S)-3,4,7,3',4'-Pentahydroxyflavan&& | + | |Common Name=&&ent-Epifisetinidol-4beta-ol&& (2S,3S,4S) -3,4,7,3',4'-Pentahydroxyflavan&& |
|CAS=967-28-2 | |CAS=967-28-2 | ||
|KNApSAcK=C00008999 | |KNApSAcK=C00008999 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 967-28-2 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL6D1CNS0005.mol |
ent-Epifisetinidol-4beta-ol | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (2S,3S,4S) -3,4,7,3',4'-Pentahydroxyflavan |
Common Name |
|
Symbol | |
Formula | C15H14O6 |
Exact Mass | 290.07903818 |
Average Mass | 290.26806 |
SMILES | Oc(c3)cc(O1)c(c3)C(O)C(O)C1c(c2)cc(O)c(O)c2 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|