FL5FECGL0009
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 128351-79-1 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FECGL0009.mol |
Quercetagetin 3'-methyl ether 3-glucoside | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 3,5,6,7,4'-Pentahydroxy-3'-methoxyflavone 3-glucoside |
Common Name |
|
Symbol | |
Formula | C22H22O13 |
Exact Mass | 494.10604078999995 |
Average Mass | 494.40228 |
SMILES | O(C(C3=O)=C(c(c4)cc(OC)c(O)c4)Oc(c23)cc(c(c2O)O)O) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|
|