FL5FDJGS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=5,7,3',5'-Tetrahydroxy-3,4'-dimethoxyflavone 3'-xyloside | |SysName=5,7,3',5'-Tetrahydroxy-3,4'-dimethoxyflavone 3'-xyloside | ||
| − | |Common Name=&&Myricetin 3,4'-dimethyl ether 3'-xyloside&& | + | |Common Name=&&Myricetin 3,4'-dimethyl ether 3'-xyloside&&5,7,3',5'-Tetrahydroxy-3,4'-dimethoxyflavone 3'-xyloside&& |
|CAS=102506-58-1 | |CAS=102506-58-1 | ||
|KNApSAcK=C00005772 | |KNApSAcK=C00005772 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 102506-58-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FDJGS0001.mol |
| Myricetin 3,4'-dimethyl ether 3'-xyloside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,3',5'-Tetrahydroxy-3,4'-dimethoxyflavone 3'-xyloside |
| Common Name |
|
| Symbol | |
| Formula | C22H22O12 |
| Exact Mass | 478.111126168 |
| Average Mass | 478.40288000000004 |
| SMILES | c(c2C(=C(OC)4)Oc(c3)c(C4=O)c(cc3O)O)c(O)c(OC)c(c2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
