FL5FA9NI0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=3,5,7-Trihydroxy-8-(3-methyl-2-butenyl)-2-phenyl-4H-1-benzopyran-4-one | + | |SysName=3,5,7-Trihydroxy-8- (3-methyl-2-butenyl) -2-phenyl-4H-1-benzopyran-4-one |
| − | |Common Name=&&Glepidotin A&&3,5,7-Trihydroxy-8-(3-methyl-2-butenyl)-2-phenyl-4H-1-benzopyran-4-one&& | + | |Common Name=&&Glepidotin A&&3,5,7-Trihydroxy-8- (3-methyl-2-butenyl) -2-phenyl-4H-1-benzopyran-4-one&& |
|CAS=42193-83-9 | |CAS=42193-83-9 | ||
|KNApSAcK=C00001045 | |KNApSAcK=C00001045 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 42193-83-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FA9NI0001.mol |
| Glepidotin A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7-Trihydroxy-8- (3-methyl-2-butenyl) -2-phenyl-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C20H18O5 |
| Exact Mass | 338.115423686 |
| Average Mass | 338.35392 |
| SMILES | c(c3O)(c2c(CC=C(C)C)c(O)c3)C(C(=C(O2)c(c1)cccc1)O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
