FL5F3CNS0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=2-(3,4-Dihydroxyphenyl)-3,7,8-trihydroxy-4H-1-benzopyran-4-one | + | |SysName=2- (3,4-Dihydroxyphenyl) -3,7,8-trihydroxy-4H-1-benzopyran-4-one |
− | |Common Name=&&3,7,8,3',4'-Pentahydroxyflavone&&Melanoxetin&&2-(3,4-Dihydroxyphenyl)-3,7,8-trihydroxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&3,7,8,3',4'-Pentahydroxyflavone&&Melanoxetin&&2- (3,4-Dihydroxyphenyl) -3,7,8-trihydroxy-4H-1-benzopyran-4-one&& |
|CAS=489-58-7 | |CAS=489-58-7 | ||
|KNApSAcK=C00004660 | |KNApSAcK=C00004660 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 489-58-7 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5F3CNS0001.mol |
3,7,8,3',4'-Pentahydroxyflavone | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 2- (3,4-Dihydroxyphenyl) -3,7,8-trihydroxy-4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C15H10O7 |
Exact Mass | 302.042652674 |
Average Mass | 302.2357 |
SMILES | Oc(c3)c(O)cc(c3)C(O1)=C(O)C(=O)c(c2)c1c(O)c(O)c2 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|