FL4DDANS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=5,7,4'-Trihydroxy-3-methoxyflavanone | |SysName=5,7,4'-Trihydroxy-3-methoxyflavanone | ||
| − | |Common Name=&&Aromadendrin 3-methyl ether&& | + | |Common Name=&&Aromadendrin 3-methyl ether&&5,7,4'-Trihydroxy-3-methoxyflavanone&& |
|CAS=97231-20-4 | |CAS=97231-20-4 | ||
|KNApSAcK=C00008554 | |KNApSAcK=C00008554 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 97231-20-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DDANS0001.mol |
| Aromadendrin 3-methyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,4'-Trihydroxy-3-methoxyflavanone |
| Common Name |
|
| Symbol | |
| Formula | C16H14O6 |
| Exact Mass | 302.07903818 |
| Average Mass | 302.27876000000003 |
| SMILES | CO[C@@H](C(=O)2)[C@H](Oc(c3)c(c(O)cc(O)3)2)c(c1)cc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
