FL4DACGS0007
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |SysName=(2R,3R)-3-(beta-D-Glucopyranosyloxy)-2-(3,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one |
|Common Name=&&(2R,3R)-Taxifolin 3-glucoside&& | |Common Name=&&(2R,3R)-Taxifolin 3-glucoside&& | ||
|CAS=27297-45-6 | |CAS=27297-45-6 | ||
|KNApSAcK=C00008699 | |KNApSAcK=C00008699 | ||
}} | }} |
Revision as of 09:00, 13 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 27297-45-6 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL4DACGS0007.mol |
(2R,3R)-Taxifolin 3-glucoside | |
---|---|
Structural Information | |
Systematic Name | (2R,3R)-3-(beta-D-Glucopyranosyloxy)-2-(3,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C21H22O12 |
Exact Mass | 466.111126168 |
Average Mass | 466.39218 |
SMILES | O(C(C(=O)3)C(Oc(c4)c3c(cc(O)4)O)c(c2)cc(c(O)c2)O)C |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |