FL4DA8NP0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(3R)-3-Methoxyminimiflorin | + | |SysName=(3R)-3-Methoxyminimiflorin |
|Common Name=&&(3R)-3-Methoxyminimiflorin&&5,2'-Dihydroxy-3-methoxy-8-prenyl-6",6"-dimethylpyrano[2",3":7,6]flavanone&& | |Common Name=&&(3R)-3-Methoxyminimiflorin&&5,2'-Dihydroxy-3-methoxy-8-prenyl-6",6"-dimethylpyrano[2",3":7,6]flavanone&& | ||
|CAS=259812-80-1 | |CAS=259812-80-1 | ||
|KNApSAcK=C00014396 | |KNApSAcK=C00014396 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 259812-80-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DA8NP0002.mol |
| (3R)-3-Methoxyminimiflorin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (3R)-3-Methoxyminimiflorin |
| Common Name |
|
| Symbol | |
| Formula | C26H28O6 |
| Exact Mass | 436.188588628 |
| Average Mass | 436.49692 |
| SMILES | O(C(C)(C)4)c(c(CC=C(C)C)1)c(C=C4)c(O)c(C(=O)2)c1OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
