FL3FGLNS0002
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 1: | Line 1: | ||
| {{Metabolite | {{Metabolite | ||
| − | |SysName=2-(2,4-Dihydroxy-5-methoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-1-benzopyran-4-one | + | |SysName=2- (2,4-Dihydroxy-5-methoxyphenyl) -5-hydroxy-6,7,8-trimethoxy-4H-1-benzopyran-4-one | 
| − | |Common Name=&&Agecorynin D&&2-(2,4-Dihydroxy-5-methoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&Agecorynin D&&2- (2,4-Dihydroxy-5-methoxyphenyl) -5-hydroxy-6,7,8-trimethoxy-4H-1-benzopyran-4-one&& | 
| |CAS=77053-48-6 | |CAS=77053-48-6 | ||
| |KNApSAcK=C00003966 | |KNApSAcK=C00003966 | ||
| }} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 77053-48-6 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FGLNS0002.mol | 
| Agecorynin D | |
|---|---|
|   | |
| Structural Information | |
| Systematic Name | 2- (2,4-Dihydroxy-5-methoxyphenyl) -5-hydroxy-6,7,8-trimethoxy-4H-1-benzopyran-4-one | 
| Common Name | 
 | 
| Symbol | |
| Formula | C19H18O9 | 
| Exact Mass | 390.095082174 | 
| Average Mass | 390.34082 | 
| SMILES | c(c(C(O2)=CC(c(c3O)c2c(c(c3OC)OC)OC)=O)1)(O)cc(O)c | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | 
