FL3FGANS0006
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=Xanthomicrol | + | |SysName=Xanthomicrol |
|Common Name=&&Xanthomicrol&&5-Hydroxy-2-(4-hydroxyphenyl)-6,7,8-trimethoxy-4H-1-benzopyran-4-one&& | |Common Name=&&Xanthomicrol&&5-Hydroxy-2-(4-hydroxyphenyl)-6,7,8-trimethoxy-4H-1-benzopyran-4-one&& | ||
|CAS=16545-23-6 | |CAS=16545-23-6 | ||
|KNApSAcK=C00003879 | |KNApSAcK=C00003879 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 16545-23-6 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FGANS0006.mol |
Xanthomicrol | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Xanthomicrol |
Common Name |
|
Symbol | |
Formula | C18H16O7 |
Exact Mass | 344.089602866 |
Average Mass | 344.31543999999997 |
SMILES | c(C(O2)=CC(c(c3O)c2c(c(c3OC)OC)OC)=O)(c1)ccc(O)c1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |