FL3FF8NS0008
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=5,2',6'-Trihydroxy-7,8-dimethoxyflavone | |SysName=5,2',6'-Trihydroxy-7,8-dimethoxyflavone | ||
| − | |Common Name=&&Viscidulin II&& | + | |Common Name=&&Viscidulin II&&5,2',6'-Trihydroxy-7,8-dimethoxyflavone&& |
|CAS=92519-93-2 | |CAS=92519-93-2 | ||
|KNApSAcK=C00003902 | |KNApSAcK=C00003902 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 92519-93-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FF8NS0008.mol |
| Viscidulin II | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,2',6'-Trihydroxy-7,8-dimethoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C17H14O7 |
| Exact Mass | 330.073952802 |
| Average Mass | 330.28886 |
| SMILES | COc(c3)c(OC)c(O1)c(c(O)3)C(=O)C=C1c(c(O)2)c(O)ccc2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
