FL3FELNS0008
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=Agecorynin F | + | |SysName=Agecorynin F |
|Common Name=&&Agecorynin F&&5-Hydroxy-6,7-dimethoxy-2-(2,3,4,5-tetramethoxyphenyl)-4H-1-benzopyran-4-one&& | |Common Name=&&Agecorynin F&&5-Hydroxy-6,7-dimethoxy-2-(2,3,4,5-tetramethoxyphenyl)-4H-1-benzopyran-4-one&& | ||
|CAS=144525-23-5 | |CAS=144525-23-5 | ||
|KNApSAcK=C00004084 | |KNApSAcK=C00004084 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 144525-23-5 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FELNS0008.mol |
Agecorynin F | |
---|---|
Structural Information | |
Systematic Name | Agecorynin F |
Common Name |
|
Symbol | |
Formula | C21H22O9 |
Exact Mass | 418.126382302 |
Average Mass | 418.39398 |
SMILES | COc(c3OC)cc(c2c3O)OC(=CC(=O)2)c(c1OC)cc(c(c1OC)OC) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|