FL3FCDGS0004
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2-[4-[(2-O-D-Apio-beta-D-furanosyl-beta-D-glucopyranosyl)oxy]-3-methoxyphenyl]-5-hydroxy-7-methoxy-4H-1-benzopyran-4-one | + | |SysName=2- [ 4- [ (2-O-D-Apio-beta-D-furanosyl-beta-D-glucopyranosyl) oxy ] -3-methoxyphenyl ] -5-hydroxy-7-methoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&Homoflavoyadorinin B&&Luteolin 7,3'-dimethyl ether 4'-apiosyl-(1->2)-glucoside&&2-[4-[(2-O-D-Apio-beta-D-furanosyl-beta-D-glucopyranosyl)oxy]-3-methoxyphenyl]-5-hydroxy-7-methoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&Homoflavoyadorinin B&&Luteolin 7,3'-dimethyl ether 4'-apiosyl- (1->2) -glucoside&&2- [ 4- [ (2-O-D-Apio-beta-D-furanosyl-beta-D-glucopyranosyl) oxy ] -3-methoxyphenyl ] -5-hydroxy-7-methoxy-4H-1-benzopyran-4-one&& |
|CAS=30422-47-0 | |CAS=30422-47-0 | ||
|KNApSAcK=C00004372 | |KNApSAcK=C00004372 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 30422-47-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FCDGS0004.mol |
| Homoflavoyadorinin B | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- [ 4- [ (2-O-D-Apio-beta-D-furanosyl-beta-D-glucopyranosyl) oxy ] -3-methoxyphenyl ] -5-hydroxy-7-methoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C28H32O15 |
| Exact Mass | 608.174120354 |
| Average Mass | 608.54468 |
| SMILES | O(c(c(OC)3)ccc(C(=C5)Oc(c4)c(C5=O)c(O)cc(OC)4)c3)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
